C17H23N3O5 — CID 108501814
ethyl 2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetyl]amino]benzoate (PubChem CID 108501814) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108501814 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | ethyl 2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C17H23N3O5/c1-2-25-17(24)13-5-3-4-6-14(13)18-15(22)16(23)20-9-7-19(8-10-20)11-12-21/h3-6,21H,2,7-12H2,1H3,(H,18,22) |
| InChIKey | JXBOYEICKODUBF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|