C20H29N3O4 — CID 108961005
ethyl 2-[[3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate (PubChem CID 108961005) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 2-[[3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108961005 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl 2-[[3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(C)(C)C(=O)N1CCN(CC)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-5-22-11-13-23(14-12-22)19(26)20(3,4)18(25)21-16-10-8-7-9-15(16)17(24)27-6-2/h7-10H,5-6,11-14H2,1-4H3,(H,21,25) |
| InChIKey | BJZGZTQXHGOXEQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|