C20H28N4 — CID 112872082
6-(2-ethylpiperidin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidin-4-amine (PubChem CID 112872082) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 6-(2-ethylpiperidin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidin-4-amine.
| Compound Name | 6-(2-ethylpiperidin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112872082 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 6-(2-ethylpiperidin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1cc(NC(C)c2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C20H28N4/c1-4-18-12-8-9-13-24(18)20-14-19(22-16(3)23-20)21-15(2)17-10-6-5-7-11-17/h5-7,10-11,14-15,18H,4,8-9,12-13H2,1-3H3,(H,21,22,23) |
| InChIKey | VJONGQODBDNXQN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |