C19H23F3N4 — CID 112876497
6-(2-ethylpiperidin-1-yl)-2-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 112876497) has the molecular formula C19H23F3N4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 6-(2-ethylpiperidin-1-yl)-2-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-(2-ethylpiperidin-1-yl)-2-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112876497 |
| Molecular Formula | C19H23F3N4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 6-(2-ethylpiperidin-1-yl)-2-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1cc(Nc2ccccc2C(F)(F)F)nc(C)n1 |
| InChI | InChI=1S/C19H23F3N4/c1-3-14-8-6-7-11-26(14)18-12-17(23-13(2)24-18)25-16-10-5-4-9-15(16)19(20,21)22/h4-5,9-10,12,14H,3,6-8,11H2,1-2H3,(H,23,24,25) |
| InChIKey | DRLULFFBTLFUCK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |