C20H22F3N3O — CID 109175655
(2-ethylpiperidin-1-yl)-[2-[2-(trifluoromethyl)anilino]-4-pyridinyl]methanone (PubChem CID 109175655) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is (2-ethylpiperidin-1-yl)-[2-[2-(trifluoromethyl)anilino]-4-pyridinyl]methanone.
| Compound Name | (2-ethylpiperidin-1-yl)-[2-[2-(trifluoromethyl)anilino]-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 109175655 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2-ethylpiperidin-1-yl)-[2-[2-(trifluoromethyl)anilino]-4-pyridinyl]methanone |
| SMILES | CCC1CCCCN1C(=O)c1ccnc(Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3N3O/c1-2-15-7-5-6-12-26(15)19(27)14-10-11-24-18(13-14)25-17-9-4-3-8-16(17)20(21,22)23/h3-4,8-11,13,15H,2,5-7,12H2,1H3,(H,24,25) |
| InChIKey | IPFUSGHOYHCOHL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |