C24H32N4O — CID 45173718
[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]-(4-phenylazepan-1-yl)methanone (PubChem CID 45173718) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is [6-(4-ethylpiperazin-1-yl)-3-pyridinyl]-(4-phenylazepan-1-yl)methanone.
| Compound Name | [6-(4-ethylpiperazin-1-yl)-3-pyridinyl]-(4-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 45173718 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [6-(4-ethylpiperazin-1-yl)-3-pyridinyl]-(4-phenylazepan-1-yl)methanone |
| SMILES | CCN1CCN(c2ccc(C(=O)N3CCCC(c4ccccc4)CC3)cn2)CC1 |
| InChI | InChI=1S/C24H32N4O/c1-2-26-15-17-27(18-16-26)23-11-10-22(19-25-23)24(29)28-13-6-9-21(12-14-28)20-7-4-3-5-8-20/h3-5,7-8,10-11,19,21H,2,6,9,12-18H2,1H3 |
| InChIKey | FNVRYFVVPLRPDS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |