C21H28N4O — CID 95215160
[6-[2-(methylamino)ethylamino]-3-pyridinyl]-[(4S)-4-phenylazepan-1-yl]methanone (PubChem CID 95215160) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is [6-[2-(methylamino)ethylamino]-3-pyridinyl]-[(4S)-4-phenylazepan-1-yl]methanone.
| Compound Name | [6-[2-(methylamino)ethylamino]-3-pyridinyl]-[(4S)-4-phenylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 95215160 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | [6-[2-(methylamino)ethylamino]-3-pyridinyl]-[(4S)-4-phenylazepan-1-yl]methanone |
| SMILES | CNCCNc1ccc(C(=O)N2CCC[C@H](c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C21H28N4O/c1-22-12-13-23-20-10-9-19(16-24-20)21(26)25-14-5-8-18(11-15-25)17-6-3-2-4-7-17/h2-4,6-7,9-10,16,18,22H,5,8,11-15H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | DIUDNAPJMAVGFE-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|