C24H25N3O2 — CID 95218046
[6-(6-methoxy-3-pyridinyl)-3-pyridinyl]-[(4R)-4-phenylazepan-1-yl]methanone (PubChem CID 95218046) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is [6-(6-methoxy-3-pyridinyl)-3-pyridinyl]-[(4R)-4-phenylazepan-1-yl]methanone.
| Compound Name | [6-(6-methoxy-3-pyridinyl)-3-pyridinyl]-[(4R)-4-phenylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 95218046 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | [6-(6-methoxy-3-pyridinyl)-3-pyridinyl]-[(4R)-4-phenylazepan-1-yl]methanone |
| SMILES | COc1ccc(-c2ccc(C(=O)N3CCC[C@@H](c4ccccc4)CC3)cn2)cn1 |
| InChI | InChI=1S/C24H25N3O2/c1-29-23-12-10-20(16-26-23)22-11-9-21(17-25-22)24(28)27-14-5-8-19(13-15-27)18-6-3-2-4-7-18/h2-4,6-7,9-12,16-17,19H,5,8,13-15H2,1H3/t19-/m1/s1 |
| InChIKey | LGFMDUYOCJSYHR-LJQANCHMSA-N |
| XLogP | 4.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |