C25H26N2O2 — CID 56862935
[6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-(4-phenylazepan-1-yl)methanone (PubChem CID 56862935) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is [6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-(4-phenylazepan-1-yl)methanone.
| Compound Name | [6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-(4-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 56862935 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-(4-phenylazepan-1-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccc(CO)cc2)nc1)N1CCCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26N2O2/c28-18-19-8-10-22(11-9-19)24-13-12-23(17-26-24)25(29)27-15-4-7-21(14-16-27)20-5-2-1-3-6-20/h1-3,5-6,8-13,17,21,28H,4,7,14-16,18H2 |
| InChIKey | JSSJZOTXHCZCSC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |