C14H25N3O2 — CID 170568898
ethane;6-(3-methoxyazetidin-1-yl)pyridine-3-carboxamide (PubChem CID 170568898) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is ethane;6-(3-methoxyazetidin-1-yl)pyridine-3-carboxamide.
| Compound Name | ethane;6-(3-methoxyazetidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170568898 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | ethane;6-(3-methoxyazetidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC.CC.COC1CN(c2ccc(C(N)=O)cn2)C1 |
| InChI | InChI=1S/C10H13N3O2.2C2H6/c1-15-8-5-13(6-8)9-3-2-7(4-12-9)10(11)14;2*1-2/h2-4,8H,5-6H2,1H3,(H2,11,14);2*1-2H3 |
| InChIKey | GZLCVHTVDSAORA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |