C11H15N3O3 — CID 79839721
6-[2-(hydroxymethyl)morpholin-4-yl]pyridine-3-carboxamide (PubChem CID 79839721) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)morpholin-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-[2-(hydroxymethyl)morpholin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79839721 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 6-[2-(hydroxymethyl)morpholin-4-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCOC(CO)C2)nc1 |
| InChI | InChI=1S/C11H15N3O3/c12-11(16)8-1-2-10(13-5-8)14-3-4-17-9(6-14)7-15/h1-2,5,9,15H,3-4,6-7H2,(H2,12,16) |
| InChIKey | ORVKXXUDBCKISL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |