C11H16N2O3 — CID 106504669
[4-(5-methoxy-2-pyridinyl)morpholin-2-yl]methanol (PubChem CID 106504669) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is [4-(5-methoxy-2-pyridinyl)morpholin-2-yl]methanol.
| Compound Name | [4-(5-methoxy-2-pyridinyl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 106504669 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | [4-(5-methoxy-2-pyridinyl)morpholin-2-yl]methanol |
| SMILES | COc1ccc(N2CCOC(CO)C2)nc1 |
| InChI | InChI=1S/C11H16N2O3/c1-15-9-2-3-11(12-6-9)13-4-5-16-10(7-13)8-14/h2-3,6,10,14H,4-5,7-8H2,1H3 |
| InChIKey | ZPHJNYYXIKXFPB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |