C10H15N3O2S — CID 106973462
[4-(6-methylsulfanylpyrimidin-4-yl)morpholin-2-yl]methanol (PubChem CID 106973462) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is [4-(6-methylsulfanylpyrimidin-4-yl)morpholin-2-yl]methanol.
| Compound Name | [4-(6-methylsulfanylpyrimidin-4-yl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 106973462 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [4-(6-methylsulfanylpyrimidin-4-yl)morpholin-2-yl]methanol |
| SMILES | CSc1cc(N2CCOC(CO)C2)ncn1 |
| InChI | InChI=1S/C10H15N3O2S/c1-16-10-4-9(11-7-12-10)13-2-3-15-8(5-13)6-14/h4,7-8,14H,2-3,5-6H2,1H3 |
| InChIKey | FSMVMKGLQIRQEJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |