C10H16N4S — CID 106973343
(3R)-1-(6-methylsulfanylpyrimidin-4-yl)piperidin-3-amine (PubChem CID 106973343) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is (3R)-1-(6-methylsulfanylpyrimidin-4-yl)piperidin-3-amine.
| Compound Name | (3R)-1-(6-methylsulfanylpyrimidin-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 106973343 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (3R)-1-(6-methylsulfanylpyrimidin-4-yl)piperidin-3-amine |
| SMILES | CSc1cc(N2CCC[C@@H](N)C2)ncn1 |
| InChI | InChI=1S/C10H16N4S/c1-15-10-5-9(12-7-13-10)14-4-2-3-8(11)6-14/h5,7-8H,2-4,6,11H2,1H3/t8-/m1/s1 |
| InChIKey | DDDWDVBGVCNQAN-MRVPVSSYSA-N |
| XLogP | 1.13 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |