C11H19N5 — CID 53185813
6-(3-aminopiperidin-1-yl)-N,N-dimethylpyrimidin-4-amine (PubChem CID 53185813) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 6-(3-aminopiperidin-1-yl)-N,N-dimethylpyrimidin-4-amine.
| Compound Name | 6-(3-aminopiperidin-1-yl)-N,N-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 53185813 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 6-(3-aminopiperidin-1-yl)-N,N-dimethylpyrimidin-4-amine |
| SMILES | CN(C)c1cc(N2CCCC(N)C2)ncn1 |
| InChI | InChI=1S/C11H19N5/c1-15(2)10-6-11(14-8-13-10)16-5-3-4-9(12)7-16/h6,8-9H,3-5,7,12H2,1-2H3 |
| InChIKey | VAPZPTWJFVHOPJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |