C19H24FN5O — CID 95107896
N-[(3R)-1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 95107896) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(3R)-1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(3R)-1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 95107896 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N-[(3R)-1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | CN(C)c1cc(N2CCC[C@@H](NC(=O)Cc3ccc(F)cc3)C2)ncn1 |
| InChI | InChI=1S/C19H24FN5O/c1-24(2)17-11-18(22-13-21-17)25-9-3-4-16(12-25)23-19(26)10-14-5-7-15(20)8-6-14/h5-8,11,13,16H,3-4,9-10,12H2,1-2H3,(H,23,26)/t16-/m1/s1 |
| InChIKey | IFKYHUKBEJITJU-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |