C9H15N5O2 — CID 81217236
[4-(2,6-diaminopyrimidin-4-yl)morpholin-2-yl]methanol (PubChem CID 81217236) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is [4-(2,6-diaminopyrimidin-4-yl)morpholin-2-yl]methanol.
| Compound Name | [4-(2,6-diaminopyrimidin-4-yl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81217236 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [4-(2,6-diaminopyrimidin-4-yl)morpholin-2-yl]methanol |
| SMILES | Nc1cc(N2CCOC(CO)C2)nc(N)n1 |
| InChI | InChI=1S/C9H15N5O2/c10-7-3-8(13-9(11)12-7)14-1-2-16-6(4-14)5-15/h3,6,15H,1-2,4-5H2,(H4,10,11,12,13) |
| InChIKey | KKDJOWULAVFQCC-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |