C9H15N5O — CID 80794344
[1-(2,6-diaminopyrimidin-4-yl)pyrrolidin-2-yl]methanol (PubChem CID 80794344) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is [1-(2,6-diaminopyrimidin-4-yl)pyrrolidin-2-yl]methanol.
| Compound Name | [1-(2,6-diaminopyrimidin-4-yl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 80794344 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | [1-(2,6-diaminopyrimidin-4-yl)pyrrolidin-2-yl]methanol |
| SMILES | Nc1cc(N2CCCC2CO)nc(N)n1 |
| InChI | InChI=1S/C9H15N5O/c10-7-4-8(13-9(11)12-7)14-3-1-2-6(14)5-15/h4,6,15H,1-3,5H2,(H4,10,11,12,13) |
| InChIKey | SIENXGHYUDUGRN-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |