C9H14N4O — CID 79033972
[1-(6-aminopyrazin-2-yl)pyrrolidin-2-yl]methanol (PubChem CID 79033972) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is [1-(6-aminopyrazin-2-yl)pyrrolidin-2-yl]methanol.
| Compound Name | [1-(6-aminopyrazin-2-yl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 79033972 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [1-(6-aminopyrazin-2-yl)pyrrolidin-2-yl]methanol |
| SMILES | Nc1cncc(N2CCCC2CO)n1 |
| InChI | InChI=1S/C9H14N4O/c10-8-4-11-5-9(12-8)13-3-1-2-7(13)6-14/h4-5,7,14H,1-3,6H2,(H2,10,12) |
| InChIKey | ASDLYZGFXFVBNA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |