C16H23N3O5 — CID 120965247
2-[[4-(5-ethoxycarbonyl-2-pyridinyl)morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 120965247) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[[4-(5-ethoxycarbonyl-2-pyridinyl)morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-(5-ethoxycarbonyl-2-pyridinyl)morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 120965247 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[[4-(5-ethoxycarbonyl-2-pyridinyl)morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CCOC(=O)c1ccc(N2CCOC(CN(C)CC(=O)O)C2)nc1 |
| InChI | InChI=1S/C16H23N3O5/c1-3-23-16(22)12-4-5-14(17-8-12)19-6-7-24-13(10-19)9-18(2)11-15(20)21/h4-5,8,13H,3,6-7,9-11H2,1-2H3,(H,20,21) |
| InChIKey | AKQYBYQCRGTBDO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |