C13H15N3O3 — CID 78946431
ethyl 6-(2-cyanomorpholin-4-yl)pyridine-3-carboxylate (PubChem CID 78946431) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 6-(2-cyanomorpholin-4-yl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(2-cyanomorpholin-4-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 78946431 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl 6-(2-cyanomorpholin-4-yl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCOC(C#N)C2)nc1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-18-13(17)10-3-4-12(15-8-10)16-5-6-19-11(7-14)9-16/h3-4,8,11H,2,5-6,9H2,1H3 |
| InChIKey | TTYHTBVHFFPIAZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |