C16H18N2O3S — CID 133363565
ethyl 6-(2-thiophen-2-ylmorpholin-4-yl)pyridine-3-carboxylate (PubChem CID 133363565) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is ethyl 6-(2-thiophen-2-ylmorpholin-4-yl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(2-thiophen-2-ylmorpholin-4-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133363565 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | ethyl 6-(2-thiophen-2-ylmorpholin-4-yl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCOC(c3cccs3)C2)nc1 |
| InChI | InChI=1S/C16H18N2O3S/c1-2-20-16(19)12-5-6-15(17-10-12)18-7-8-21-13(11-18)14-4-3-9-22-14/h3-6,9-10,13H,2,7-8,11H2,1H3 |
| InChIKey | JVNYWSNNIJNIGO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |