C14H21N3O4S — CID 36834270
ethyl 6-[(3S)-3-(methanesulfonamido)piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 36834270) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is ethyl 6-[(3S)-3-(methanesulfonamido)piperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(3S)-3-(methanesulfonamido)piperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 36834270 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 6-[(3S)-3-(methanesulfonamido)piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCC[C@H](NS(C)(=O)=O)C2)nc1 |
| InChI | InChI=1S/C14H21N3O4S/c1-3-21-14(18)11-6-7-13(15-9-11)17-8-4-5-12(10-17)16-22(2,19)20/h6-7,9,12,16H,3-5,8,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | AHUOYZXNUPVQBS-LBPRGKRZSA-N |
| XLogP | 0.78 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |