C12H15N3O4 — CID 66284729
methyl 4-(2-methoxycarbonylpyrrolidin-1-yl)pyrimidine-2-carboxylate (PubChem CID 66284729) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is methyl 4-(2-methoxycarbonylpyrrolidin-1-yl)pyrimidine-2-carboxylate.
| Compound Name | methyl 4-(2-methoxycarbonylpyrrolidin-1-yl)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66284729 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 4-(2-methoxycarbonylpyrrolidin-1-yl)pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(N2CCCC2C(=O)OC)n1 |
| InChI | InChI=1S/C12H15N3O4/c1-18-11(16)8-4-3-7-15(8)9-5-6-13-10(14-9)12(17)19-2/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | WRGHITYFXAVTLL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |