C13H17N3O2S — CID 115534797
methyl 1-(6-carbamothioyl-3-pyridinyl)piperidine-2-carboxylate (PubChem CID 115534797) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is methyl 1-(6-carbamothioyl-3-pyridinyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(6-carbamothioyl-3-pyridinyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115534797 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | methyl 1-(6-carbamothioyl-3-pyridinyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-18-13(17)11-4-2-3-7-16(11)9-5-6-10(12(14)19)15-8-9/h5-6,8,11H,2-4,7H2,1H3,(H2,14,19) |
| InChIKey | GDJPQRLBRICTSI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|