C14H19NO4S — CID 115538364
methyl 1-(4-methylsulfonylphenyl)piperidine-2-carboxylate (PubChem CID 115538364) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is methyl 1-(4-methylsulfonylphenyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(4-methylsulfonylphenyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115538364 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 1-(4-methylsulfonylphenyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-19-14(16)13-5-3-4-10-15(13)11-6-8-12(9-7-11)20(2,17)18/h6-9,13H,3-5,10H2,1-2H3 |
| InChIKey | PDFQNWOPTXIRIS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |