C11H14N2O2 — CID 96706511
methyl (2R)-1-pyridin-3-ylpyrrolidine-2-carboxylate (PubChem CID 96706511) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is methyl (2R)-1-pyridin-3-ylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-pyridin-3-ylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 96706511 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl (2R)-1-pyridin-3-ylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1c1cccnc1 |
| InChI | InChI=1S/C11H14N2O2/c1-15-11(14)10-5-3-7-13(10)9-4-2-6-12-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m1/s1 |
| InChIKey | BGFIVJOIQLIGCT-SNVBAGLBSA-N |
| XLogP | 1.22 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |