C12H16N2O4S — CID 49454499
methyl 1-pyridin-3-ylsulfonylpiperidine-2-carboxylate (PubChem CID 49454499) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 1-pyridin-3-ylsulfonylpiperidine-2-carboxylate.
| Compound Name | methyl 1-pyridin-3-ylsulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 49454499 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 1-pyridin-3-ylsulfonylpiperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C12H16N2O4S/c1-18-12(15)11-6-2-3-8-14(11)19(16,17)10-5-4-7-13-9-10/h4-5,7,9,11H,2-3,6,8H2,1H3 |
| InChIKey | NLROHFJWRAPZPM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |