C11H16N2O4S — CID 113330736
methyl 1-(1H-pyrrol-3-ylsulfonyl)piperidine-2-carboxylate (PubChem CID 113330736) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 1-(1H-pyrrol-3-ylsulfonyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(1H-pyrrol-3-ylsulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 113330736 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 1-(1H-pyrrol-3-ylsulfonyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1S(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C11H16N2O4S/c1-17-11(14)10-4-2-3-7-13(10)18(15,16)9-5-6-12-8-9/h5-6,8,10,12H,2-4,7H2,1H3 |
| InChIKey | MXRDSQBBHSVPGA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |