C21H19ClN4O2 — CID 156866200
methyl (2S)-1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]pyrrolidine-2-carboxylate (PubChem CID 156866200) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is methyl (2S)-1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 156866200 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | methyl (2S)-1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1c1cc(-c2ccc(Cl)cc2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C21H19ClN4O2/c1-28-21(27)18-5-3-11-26(18)19-12-17(14-6-8-16(22)9-7-14)24-20(25-19)15-4-2-10-23-13-15/h2,4,6-10,12-13,18H,3,5,11H2,1H3/t18-/m0/s1 |
| InChIKey | DICRUVVZLFSKBJ-SFHVURJKSA-N |
| XLogP | 4.00 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |