C21H22ClN5 — CID 175342252
1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]-N-methylpiperidin-3-amine (PubChem CID 175342252) has the molecular formula C21H22ClN5 and a molecular weight of 379.90 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]-N-methylpiperidin-3-amine.
| Compound Name | 1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 175342252 |
| Molecular Formula | C21H22ClN5 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(c2cc(-c3ccc(Cl)cc3)nc(-c3cccnc3)n2)C1 |
| InChI | InChI=1S/C21H22ClN5/c1-23-18-5-3-11-27(14-18)20-12-19(15-6-8-17(22)9-7-15)25-21(26-20)16-4-2-10-24-13-16/h2,4,6-10,12-13,18,23H,3,5,11,14H2,1H3 |
| InChIKey | UURNMCPAVVCNRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |