About [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol
[1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol (PubChem CID 156865969) has the molecular formula C21H20Cl2N4O
and a molecular weight of 415.32 g/mol. Its IUPAC name is [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol |
| PubChem CID | 156865969 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2cc(-c3ccc(Cl)cc3Cl)nc(-c3cccnc3)n2)CC1 |
| InChI | InChI=1S/C21H20Cl2N4O/c22-16-3-4-17(18(23)10-16)19-11-20(27-8-5-14(13-28)6-9-27)26-21(25-19)15-2-1-7-24-12-15/h1-4,7,10-12,14,28H,5-6,8-9,13H2 |
| InChIKey | HVHVGIKUMOEILS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol?
The IUPAC name of [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol (CID 156865969) is [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol is OCC1CCN(c2cc(-c3ccc(Cl)cc3Cl)nc(-c3cccnc3)n2)CC1.
What is the InChIKey of [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol?
The InChIKey is HVHVGIKUMOEILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N4O/c22-16-3-4-17(18(23)10-16)19-11-20(27-8-5-14(13-28)6-9-27)26-21(25-19)15-2-1-7-24-12-15/h1-4,7,10-12,14,28H,5-6,8-9,13H2.
What are the key properties of [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol?
[1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol has a molecular weight of 415.32 g/mol, XLogP of 4.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[6-(2,4-dichlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol is sourced from PubChem (CID 156865969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).