C21H21ClN4O — CID 166514811
[1-[6-(2-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol (PubChem CID 166514811) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is [1-[6-(2-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol.
| Compound Name | [1-[6-(2-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 166514811 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [1-[6-(2-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2cc(-c3ccccc3Cl)nc(-c3cccnc3)n2)CC1 |
| InChI | InChI=1S/C21H21ClN4O/c22-18-6-2-1-5-17(18)19-12-20(26-10-7-15(14-27)8-11-26)25-21(24-19)16-4-3-9-23-13-16/h1-6,9,12-13,15,27H,7-8,10-11,14H2 |
| InChIKey | TVFINVPJNMRNOE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |