C24H25ClN4O2 — CID 175342086
[1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl] butanoate (PubChem CID 175342086) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is [1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl] butanoate.
| Compound Name | [1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl] butanoate |
|---|---|
| PubChem CID | 175342086 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [1-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-4-yl] butanoate |
| SMILES | CCCC(=O)OC1CCN(c2cc(-c3ccc(Cl)cc3)nc(-c3cccnc3)n2)CC1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-2-4-23(30)31-20-10-13-29(14-11-20)22-15-21(17-6-8-19(25)9-7-17)27-24(28-22)18-5-3-12-26-16-18/h3,5-9,12,15-16,20H,2,4,10-11,13-14H2,1H3 |
| InChIKey | ZJGYQLUBPMFGSW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |