C21H22ClN5O — CID 175823757
1-[4-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 175823757) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-[4-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 1-[4-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 175823757 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[4-[6-(4-chlorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | CC(O)N1CCN(c2cc(-c3ccc(Cl)cc3)nc(-c3cccnc3)n2)CC1 |
| InChI | InChI=1S/C21H22ClN5O/c1-15(28)26-9-11-27(12-10-26)20-13-19(16-4-6-18(22)7-5-16)24-21(25-20)17-3-2-8-23-14-17/h2-8,13-15,28H,9-12H2,1H3 |
| InChIKey | XRLRJEDMZQDUIR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |