C19H19Cl2N5 — CID 156865983
4-(4-chlorophenyl)-6-piperazin-1-yl-2-pyridin-3-ylpyrimidine;hydrochloride (PubChem CID 156865983) has the molecular formula C19H19Cl2N5 and a molecular weight of 388.30 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-piperazin-1-yl-2-pyridin-3-ylpyrimidine;hydrochloride.
| Compound Name | 4-(4-chlorophenyl)-6-piperazin-1-yl-2-pyridin-3-ylpyrimidine;hydrochloride |
|---|---|
| PubChem CID | 156865983 |
| Molecular Formula | C19H19Cl2N5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-(4-chlorophenyl)-6-piperazin-1-yl-2-pyridin-3-ylpyrimidine;hydrochloride |
| SMILES | Cl.Clc1ccc(-c2cc(N3CCNCC3)nc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C19H18ClN5.ClH/c20-16-5-3-14(4-6-16)17-12-18(25-10-8-21-9-11-25)24-19(23-17)15-2-1-7-22-13-15;/h1-7,12-13,21H,8-11H2;1H |
| InChIKey | XTELZYARWWIKHY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |