methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate

C11H11Cl2NO2 — CID 112581074

IUPACmethyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate
SMILESCOC(=O)C1CCN1c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NO2/c1-16-11(15)10-4-5-14(10)7-2-3-8(12)9(13)6-7/h2-3,6,10H,4-5H2,1H3
InChIKeyQKLRMXAJXPPULU-UHFFFAOYSA-N
MW260.12 g/mol
LogP2.75
Rot. Bonds2

About methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate

methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate (PubChem CID 112581074) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate.

Molecular Properties

Compound Namemethyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate
PubChem CID112581074
Molecular FormulaC11H11Cl2NO2
Molecular Weight260.12 g/mol
Exact Mass259.02
IUPAC Namemethyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate
SMILESCOC(=O)C1CCN1c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NO2/c1-16-11(15)10-4-5-14(10)7-2-3-8(12)9(13)6-7/h2-3,6,10H,4-5H2,1H3
InChIKeyQKLRMXAJXPPULU-UHFFFAOYSA-N
XLogP2.75
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.12
LogP ≤ 52.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate?
The IUPAC name of methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate (CID 112581074) is methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate.
What is the SMILES notation for methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate?
The canonical SMILES for methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate is COC(=O)C1CCN1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate?
The InChIKey is QKLRMXAJXPPULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO2/c1-16-11(15)10-4-5-14(10)7-2-3-8(12)9(13)6-7/h2-3,6,10H,4-5H2,1H3.
What are the key properties of methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate?
methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate has a molecular weight of 260.12 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3,4-dichlorophenyl)azetidine-2-carboxylate is sourced from PubChem (CID 112581074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).