About methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate
methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate (PubChem CID 112581128) has the molecular formula C12H13Cl2NO2
and a molecular weight of 274.15 g/mol. Its IUPAC name is methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate.
Analyze methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate?
The IUPAC name of methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate (CID 112581128) is methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate.
What is the SMILES notation for methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate?
The canonical SMILES for methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate is COC(=O)C1CCN1c1c(Cl)ccc(C)c1Cl.
What is the InChIKey of methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate?
The InChIKey is KXERWRLPZUKNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO2/c1-7-3-4-8(13)11(10(7)14)15-6-5-9(15)12(16)17-2/h3-4,9H,5-6H2,1-2H3.
What are the key properties of methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate?
methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate has a molecular weight of 274.15 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,6-dichloro-3-methylphenyl)azetidine-2-carboxylate is sourced from PubChem (CID 112581128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).