C11H9Cl2N3O2S — CID 112581498
methyl 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)azetidine-2-carboxylate (PubChem CID 112581498) has the molecular formula C11H9Cl2N3O2S and a molecular weight of 318.19 g/mol. Its IUPAC name is methyl 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)azetidine-2-carboxylate.
| Compound Name | methyl 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581498 |
| Molecular Formula | C11H9Cl2N3O2S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | methyl 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1c1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C11H9Cl2N3O2S/c1-18-11(17)7-2-3-16(7)10-6(13)4-5(12)8-9(10)15-19-14-8/h4,7H,2-3H2,1H3 |
| InChIKey | RXTIGXCGKBOUPS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |