About methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate
methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate (PubChem CID 112581619) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate.
Analyze methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate?
The IUPAC name of methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate (CID 112581619) is methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate.
What is the SMILES notation for methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate?
The canonical SMILES for methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate is COC(=O)C1CCN1c1c(C)cc(C)cc1Br.
What is the InChIKey of methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate?
The InChIKey is FSTLGVNJJXJBDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-8-6-9(2)12(10(14)7-8)15-5-4-11(15)13(16)17-3/h6-7,11H,4-5H2,1-3H3.
What are the key properties of methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate?
methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate has a molecular weight of 298.18 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-bromo-4,6-dimethylphenyl)azetidine-2-carboxylate is sourced from PubChem (CID 112581619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).