C11H10BrF2NO2 — CID 112581497
methyl 1-(4-bromo-2,6-difluorophenyl)azetidine-2-carboxylate (PubChem CID 112581497) has the molecular formula C11H10BrF2NO2 and a molecular weight of 306.11 g/mol. Its IUPAC name is methyl 1-(4-bromo-2,6-difluorophenyl)azetidine-2-carboxylate.
| Compound Name | methyl 1-(4-bromo-2,6-difluorophenyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581497 |
| Molecular Formula | C11H10BrF2NO2 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | methyl 1-(4-bromo-2,6-difluorophenyl)azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H10BrF2NO2/c1-17-11(16)9-2-3-15(9)10-7(13)4-6(12)5-8(10)14/h4-5,9H,2-3H2,1H3 |
| InChIKey | IMFAUUXZNDUVMF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |