C11H10Cl3NO2 — CID 112581117
methyl 1-(2,4,5-trichlorophenyl)azetidine-2-carboxylate (PubChem CID 112581117) has the molecular formula C11H10Cl3NO2 and a molecular weight of 294.56 g/mol. Its IUPAC name is methyl 1-(2,4,5-trichlorophenyl)azetidine-2-carboxylate.
| Compound Name | methyl 1-(2,4,5-trichlorophenyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581117 |
| Molecular Formula | C11H10Cl3NO2 |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | methyl 1-(2,4,5-trichlorophenyl)azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl3NO2/c1-17-11(16)9-2-3-15(9)10-5-7(13)6(12)4-8(10)14/h4-5,9H,2-3H2,1H3 |
| InChIKey | DPPUSLCVGCZSQK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|