C11H10F2N2O4 — CID 153475997
methyl (2S)-1-(2,5-difluoro-4-nitrophenyl)azetidine-2-carboxylate (PubChem CID 153475997) has the molecular formula C11H10F2N2O4 and a molecular weight of 272.21 g/mol. Its IUPAC name is methyl (2S)-1-(2,5-difluoro-4-nitrophenyl)azetidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(2,5-difluoro-4-nitrophenyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 153475997 |
| Molecular Formula | C11H10F2N2O4 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | methyl (2S)-1-(2,5-difluoro-4-nitrophenyl)azetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN1c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H10F2N2O4/c1-19-11(16)8-2-3-14(8)9-4-7(13)10(15(17)18)5-6(9)12/h4-5,8H,2-3H2,1H3/t8-/m0/s1 |
| InChIKey | KJSDVLKSANBZOE-QMMMGPOBSA-N |
| XLogP | 1.62 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|