C12H13NO4 — CID 112581145
methyl 1-(1,3-benzodioxol-5-yl)azetidine-2-carboxylate (PubChem CID 112581145) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 1-(1,3-benzodioxol-5-yl)azetidine-2-carboxylate.
| Compound Name | methyl 1-(1,3-benzodioxol-5-yl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581145 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 1-(1,3-benzodioxol-5-yl)azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13NO4/c1-15-12(14)9-4-5-13(9)8-2-3-10-11(6-8)17-7-16-10/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | DRBYZPJCSHNXFL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|