C15H22N2O2 — CID 79396771
1-(1,3-benzodioxol-5-yl)-N,2,3-trimethylpiperidin-4-amine (PubChem CID 79396771) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N,2,3-trimethylpiperidin-4-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N,2,3-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 79396771 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N,2,3-trimethylpiperidin-4-amine |
| SMILES | CNC1CCN(c2ccc3c(c2)OCO3)C(C)C1C |
| InChI | InChI=1S/C15H22N2O2/c1-10-11(2)17(7-6-13(10)16-3)12-4-5-14-15(8-12)19-9-18-14/h4-5,8,10-11,13,16H,6-7,9H2,1-3H3 |
| InChIKey | HPXWISPTXZKJCN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|