C12H14F2N2O2 — CID 112676429
methyl 1-(3,5-difluoro-2-pyridinyl)piperidine-2-carboxylate (PubChem CID 112676429) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is methyl 1-(3,5-difluoro-2-pyridinyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(3,5-difluoro-2-pyridinyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 112676429 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | methyl 1-(3,5-difluoro-2-pyridinyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1c1ncc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O2/c1-18-12(17)10-4-2-3-5-16(10)11-9(14)6-8(13)7-15-11/h6-7,10H,2-5H2,1H3 |
| InChIKey | MBWBOKNGVUHRQU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |