C15H15ClN2O3 — CID 104775264
methyl 4-(7-chloroquinolin-4-yl)morpholine-3-carboxylate (PubChem CID 104775264) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is methyl 4-(7-chloroquinolin-4-yl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(7-chloroquinolin-4-yl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 104775264 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | methyl 4-(7-chloroquinolin-4-yl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H15ClN2O3/c1-20-15(19)14-9-21-7-6-18(14)13-4-5-17-12-8-10(16)2-3-11(12)13/h2-5,8,14H,6-7,9H2,1H3 |
| InChIKey | AZORHVWUTRSZKU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |