C16H18ClN3O — CID 134032257
1-(7-chloroquinolin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 134032257) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-(7-chloroquinolin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134032257 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H18ClN3O/c1-19(2)16(21)15-4-3-9-20(15)14-7-8-18-13-10-11(17)5-6-12(13)14/h5-8,10,15H,3-4,9H2,1-2H3 |
| InChIKey | DVVFAGJIAYOWHY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |