C13H15FN2O4 — CID 104774908
methyl 4-[(3-fluorophenyl)carbamoyl]morpholine-3-carboxylate (PubChem CID 104774908) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is methyl 4-[(3-fluorophenyl)carbamoyl]morpholine-3-carboxylate.
| Compound Name | methyl 4-[(3-fluorophenyl)carbamoyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 104774908 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 4-[(3-fluorophenyl)carbamoyl]morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN2O4/c1-19-12(17)11-8-20-6-5-16(11)13(18)15-10-4-2-3-9(14)7-10/h2-4,7,11H,5-6,8H2,1H3,(H,15,18) |
| InChIKey | CBTXQPBIHPUXAQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |