C13H16N2O5 — CID 83095785
4-(3-hydroxy-4-methoxybenzoyl)morpholine-3-carboxamide (PubChem CID 83095785) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methoxybenzoyl)morpholine-3-carboxamide.
| Compound Name | 4-(3-hydroxy-4-methoxybenzoyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83095785 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-(3-hydroxy-4-methoxybenzoyl)morpholine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCOCC2C(N)=O)cc1O |
| InChI | InChI=1S/C13H16N2O5/c1-19-11-3-2-8(6-10(11)16)13(18)15-4-5-20-7-9(15)12(14)17/h2-3,6,9,16H,4-5,7H2,1H3,(H2,14,17) |
| InChIKey | FYXZUXMWFNLPBE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |